C15H27NO6 — CID 156645994
tert-butyl 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoate (PubChem CID 156645994) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is tert-butyl 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoate.
| Compound Name | tert-butyl 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoate |
|---|---|
| PubChem CID | 156645994 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | tert-butyl 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCC(=O)NCCOCCOCC=O |
| InChI | InChI=1S/C15H27NO6/c1-15(2,3)22-14(19)6-4-5-13(18)16-7-9-20-11-12-21-10-8-17/h8H,4-7,9-12H2,1-3H3,(H,16,18) |
| InChIKey | PMQORSHNUJNHKP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|