C11H19NO6 — CID 144843622
5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoic acid (PubChem CID 144843622) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoic acid.
| Compound Name | 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 144843622 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 5-oxo-5-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]pentanoic acid |
| SMILES | O=CCOCCOCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H19NO6/c13-5-7-18-9-8-17-6-4-12-10(14)2-1-3-11(15)16/h5H,1-4,6-9H2,(H,12,14)(H,15,16) |
| InChIKey | YSDYRCDDAWHWPU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|