C20H36N2O9 — CID 89212622
5-[3-[2-[2-[3-(4-carboxybutanoylamino)propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid (PubChem CID 89212622) has the molecular formula C20H36N2O9 and a molecular weight of 448.51 g/mol. Its IUPAC name is 5-[3-[2-[2-[3-(4-carboxybutanoylamino)propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid.
| Compound Name | 5-[3-[2-[2-[3-(4-carboxybutanoylamino)propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 89212622 |
| Molecular Formula | C20H36N2O9 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 5-[3-[2-[2-[3-(4-carboxybutanoylamino)propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C20H36N2O9/c23-17(5-1-7-19(25)26)21-9-3-11-29-13-15-31-16-14-30-12-4-10-22-18(24)6-2-8-20(27)28/h1-16H2,(H,21,23)(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | AHRBCCAVHSCWIG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|