C15H27NO5 — CID 58238711
CID 58238711 (PubChem CID 58238711) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol.
| Compound Name | CID 58238711 |
|---|---|
| PubChem CID | 58238711 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | — |
| SMILES | [CH]CCCOCCCCOCCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H27NO5/c1-2-3-10-20-11-4-5-12-21-13-6-9-16-14(17)7-8-15(18)19/h1H,2-13H2,(H,16,17)(H,18,19) |
| InChIKey | DJBHDJOKFPLSHW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|