C27H47N3O10 — CID 173042573
8-[3-[4-[3-[[4-[[(1S)-1-carboxy-4-oxobutyl]amino]-4-oxobutanoyl]amino]propoxy]butoxy]propylamino]-8-oxooctanoic acid (PubChem CID 173042573) has the molecular formula C27H47N3O10 and a molecular weight of 573.68 g/mol. Its IUPAC name is 8-[3-[4-[3-[[4-[[(1S)-1-carboxy-4-oxobutyl]amino]-4-oxobutanoyl]amino]propoxy]butoxy]propylamino]-8-oxooctanoic acid.
| Compound Name | 8-[3-[4-[3-[[4-[[(1S)-1-carboxy-4-oxobutyl]amino]-4-oxobutanoyl]amino]propoxy]butoxy]propylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 173042573 |
| Molecular Formula | C27H47N3O10 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | 8-[3-[4-[3-[[4-[[(1S)-1-carboxy-4-oxobutyl]amino]-4-oxobutanoyl]amino]propoxy]butoxy]propylamino]-8-oxooctanoic acid |
| SMILES | O=CCC[C@H](NC(=O)CCC(=O)NCCCOCCCCOCCCNC(=O)CCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H47N3O10/c31-17-7-10-22(27(37)38)30-25(34)14-13-24(33)29-16-9-21-40-19-6-5-18-39-20-8-15-28-23(32)11-3-1-2-4-12-26(35)36/h17,22H,1-16,18-21H2,(H,28,32)(H,29,33)(H,30,34)(H,35,36)(H,37,38)/t22-/m0/s1 |
| InChIKey | LWWLYMCRPPKSAF-QFIPXVFZSA-N |
| XLogP | 1.57 |
| TPSA | 197.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|