C26H46N2O11 — CID 173088975
10-[2-[2-[2-[2-[3-[(1-carboxy-4-oxobutyl)amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-10-oxodecanoic acid (PubChem CID 173088975) has the molecular formula C26H46N2O11 and a molecular weight of 562.66 g/mol. Its IUPAC name is 10-[2-[2-[2-[2-[3-[(1-carboxy-4-oxobutyl)amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-10-oxodecanoic acid.
| Compound Name | 10-[2-[2-[2-[2-[3-[(1-carboxy-4-oxobutyl)amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 173088975 |
| Molecular Formula | C26H46N2O11 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 10-[2-[2-[2-[2-[3-[(1-carboxy-4-oxobutyl)amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-10-oxodecanoic acid |
| SMILES | O=CCCC(NC(=O)CCOCCOCCOCCOCCNC(=O)CCCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H46N2O11/c29-13-7-8-22(26(34)35)28-24(31)11-14-36-16-18-38-20-21-39-19-17-37-15-12-27-23(30)9-5-3-1-2-4-6-10-25(32)33/h13,22H,1-12,14-21H2,(H,27,30)(H,28,31)(H,32,33)(H,34,35) |
| InChIKey | TWGJVLZNPSLGPL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 186.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|