C11H21NO5 — CID 163401026
N-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 163401026) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 163401026 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCOCC=O |
| InChI | InChI=1S/C11H21NO5/c1-2-11(14)12-3-5-15-7-9-17-10-8-16-6-4-13/h4H,2-3,5-10H2,1H3,(H,12,14) |
| InChIKey | UFYKRLZOLKHWOC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|