About molecular hydrogen;N-(2-propoxyethyl)propanamide
molecular hydrogen;N-(2-propoxyethyl)propanamide (PubChem CID 170639851) has the molecular formula C8H19NO2
and a molecular weight of 161.25 g/mol. Its IUPAC name is molecular hydrogen;N-(2-propoxyethyl)propanamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-(2-propoxyethyl)propanamide |
| PubChem CID | 170639851 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | molecular hydrogen;N-(2-propoxyethyl)propanamide |
| SMILES | CCCOCCNC(=O)CC.[H][H] |
| InChI | InChI=1S/C8H17NO2.H2/c1-3-6-11-7-5-9-8(10)4-2;/h3-7H2,1-2H3,(H,9,10);1H |
| InChIKey | FRCCWRRNVNHOHF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;N-(2-propoxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-(2-propoxyethyl)propanamide?
The IUPAC name of molecular hydrogen;N-(2-propoxyethyl)propanamide (CID 170639851) is molecular hydrogen;N-(2-propoxyethyl)propanamide.
What is the SMILES notation for molecular hydrogen;N-(2-propoxyethyl)propanamide?
The canonical SMILES for molecular hydrogen;N-(2-propoxyethyl)propanamide is CCCOCCNC(=O)CC.[H][H].
What is the InChIKey of molecular hydrogen;N-(2-propoxyethyl)propanamide?
The InChIKey is FRCCWRRNVNHOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.H2/c1-3-6-11-7-5-9-8(10)4-2;/h3-7H2,1-2H3,(H,9,10);1H.
What are the key properties of molecular hydrogen;N-(2-propoxyethyl)propanamide?
molecular hydrogen;N-(2-propoxyethyl)propanamide has a molecular weight of 161.25 g/mol, XLogP of 1.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(2-propoxyethyl)propanamide is sourced from PubChem (CID 170639851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).