C11H23NO3 — CID 153105198
N-[2-(2-butoxyethoxy)ethyl]propanamide (PubChem CID 153105198) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-[2-(2-butoxyethoxy)ethyl]propanamide.
| Compound Name | N-[2-(2-butoxyethoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 153105198 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | N-[2-(2-butoxyethoxy)ethyl]propanamide |
| SMILES | CCCCOCCOCCNC(=O)CC |
| InChI | InChI=1S/C11H23NO3/c1-3-5-7-14-9-10-15-8-6-12-11(13)4-2/h3-10H2,1-2H3,(H,12,13) |
| InChIKey | VRVUFYIFFZFCPR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|