C13H27NO5 — CID 155715449
N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-2-methoxyacetamide (PubChem CID 155715449) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 155715449 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-2-methoxyacetamide |
| SMILES | CCCCOCCOCCOCCNC(=O)COC |
| InChI | InChI=1S/C13H27NO5/c1-3-4-6-17-8-10-19-11-9-18-7-5-14-13(15)12-16-2/h3-12H2,1-2H3,(H,14,15) |
| InChIKey | HWUIXTSLLNIWEF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|