C15H29NO7 — CID 118668919
2-methoxy-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 118668919) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methoxy-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-methoxy-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 118668919 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-methoxy-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | COCC(=O)NCCOCCOCCOCCOCCC(C)=O |
| InChI | InChI=1S/C15H29NO7/c1-14(17)3-5-20-7-9-22-11-12-23-10-8-21-6-4-16-15(18)13-19-2/h3-13H2,1-2H3,(H,16,18) |
| InChIKey | KRFBBAGNEFQGAG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|