C17H32N2O8S — CID 134395772
S-[2-[2-[2-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl] ethanethioate (PubChem CID 134395772) has the molecular formula C17H32N2O8S and a molecular weight of 424.52 g/mol. Its IUPAC name is S-[2-[2-[2-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[2-[2-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 134395772 |
| Molecular Formula | C17H32N2O8S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | S-[2-[2-[2-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl] ethanethioate |
| SMILES | COCC(=O)NCCOCCOCCOCCOCCNC(=O)CSC(C)=O |
| InChI | InChI=1S/C17H32N2O8S/c1-15(20)28-14-17(22)19-4-6-25-8-10-27-12-11-26-9-7-24-5-3-18-16(21)13-23-2/h3-14H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | MVDBPCJMPFURQQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|