C7H13F2NO3 — CID 103082376
N-[2-(2,2-difluoroethoxy)ethyl]-2-methoxyacetamide (PubChem CID 103082376) has the molecular formula C7H13F2NO3 and a molecular weight of 197.18 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 103082376 |
| Molecular Formula | C7H13F2NO3 |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCOCC(F)F |
| InChI | InChI=1S/C7H13F2NO3/c1-12-5-7(11)10-2-3-13-4-6(8)9/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | IMHYTKQWBRKKNP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|