C9H16F2N2O5 — CID 106110715
3-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]-2-methoxypropanoic acid (PubChem CID 106110715) has the molecular formula C9H16F2N2O5 and a molecular weight of 270.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106110715 |
| Molecular Formula | C9H16F2N2O5 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)NCCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F2N2O5/c1-17-6(8(14)15)4-13-9(16)12-2-3-18-5-7(10)11/h6-7H,2-5H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | ZEZQXMCONYNVBM-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|