C8H17N3O6S — CID 106110030
2-methoxy-3-(3-sulfamoylpropylcarbamoylamino)propanoic acid (PubChem CID 106110030) has the molecular formula C8H17N3O6S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-methoxy-3-(3-sulfamoylpropylcarbamoylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(3-sulfamoylpropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 106110030 |
| Molecular Formula | C8H17N3O6S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-methoxy-3-(3-sulfamoylpropylcarbamoylamino)propanoic acid |
| SMILES | COC(CNC(=O)NCCCS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H17N3O6S/c1-17-6(7(12)13)5-11-8(14)10-3-2-4-18(9,15)16/h6H,2-5H2,1H3,(H,12,13)(H2,9,15,16)(H2,10,11,14) |
| InChIKey | PYYUEISVHAEEPO-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|