C7H16N2O4S — CID 115589849
2-methoxy-N-(3-sulfamoylpropyl)propanamide (PubChem CID 115589849) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-methoxy-N-(3-sulfamoylpropyl)propanamide.
| Compound Name | 2-methoxy-N-(3-sulfamoylpropyl)propanamide |
|---|---|
| PubChem CID | 115589849 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-methoxy-N-(3-sulfamoylpropyl)propanamide |
| SMILES | COC(C)C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C7H16N2O4S/c1-6(13-2)7(10)9-4-3-5-14(8,11)12/h6H,3-5H2,1-2H3,(H,9,10)(H2,8,11,12) |
| InChIKey | WGFLJRQUZQKZJF-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|