C17H20N2O3S — CID 47067593
2,2-diphenyl-N-(3-sulfamoylpropyl)acetamide (PubChem CID 47067593) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2,2-diphenyl-N-(3-sulfamoylpropyl)acetamide.
| Compound Name | 2,2-diphenyl-N-(3-sulfamoylpropyl)acetamide |
|---|---|
| PubChem CID | 47067593 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2,2-diphenyl-N-(3-sulfamoylpropyl)acetamide |
| SMILES | NS(=O)(=O)CCCNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3S/c18-23(21,22)13-7-12-19-17(20)16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2,(H,19,20)(H2,18,21,22) |
| InChIKey | JERWHHFWUGSBSO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|