C18H17NO — CID 90537904
N-but-3-ynyl-2,2-diphenylacetamide (PubChem CID 90537904) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-but-3-ynyl-2,2-diphenylacetamide.
| Compound Name | N-but-3-ynyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 90537904 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-but-3-ynyl-2,2-diphenylacetamide |
| SMILES | C#CCCNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO/c1-2-3-14-19-18(20)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4-13,17H,3,14H2,(H,19,20) |
| InChIKey | QVGWNPGAVONHCR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|