C10H18F2N2O4 — CID 114128613
2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 114128613) has the molecular formula C10H18F2N2O4 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 114128613 |
| Molecular Formula | C10H18F2N2O4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NCCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C10H18F2N2O4/c1-2-3-7(9(15)16)14-10(17)13-4-5-18-6-8(11)12/h7-8H,2-6H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | IGINMIHCCIYVJH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|