2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid

C10H18F2N2O4 — CID 114128613

IUPAC2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCCOCC(F)F)C(=O)O
InChIInChI=1S/C10H18F2N2O4/c1-2-3-7(9(15)16)14-10(17)13-4-5-18-6-8(11)12/h7-8H,2-6H2,1H3,(H,15,16)(H2,13,14,17)
InChIKeyIGINMIHCCIYVJH-UHFFFAOYSA-N
MW268.26 g/mol
LogP0.82
Rot. Bonds9

About 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid

2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 114128613) has the molecular formula C10H18F2N2O4 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid.

Molecular Properties

Compound Name2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid
PubChem CID114128613
Molecular FormulaC10H18F2N2O4
Molecular Weight268.26 g/mol
Exact Mass268.12
IUPAC Name2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCCOCC(F)F)C(=O)O
InChIInChI=1S/C10H18F2N2O4/c1-2-3-7(9(15)16)14-10(17)13-4-5-18-6-8(11)12/h7-8H,2-6H2,1H3,(H,15,16)(H2,13,14,17)
InChIKeyIGINMIHCCIYVJH-UHFFFAOYSA-N
XLogP0.82
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.26
LogP ≤ 50.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid (CID 114128613) is 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid is CCCC(NC(=O)NCCOCC(F)F)C(=O)O.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The InChIKey is IGINMIHCCIYVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O4/c1-2-3-7(9(15)16)14-10(17)13-4-5-18-6-8(11)12/h7-8H,2-6H2,1H3,(H,15,16)(H2,13,14,17).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid?
2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid has a molecular weight of 268.26 g/mol, XLogP of 0.82, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid is sourced from PubChem (CID 114128613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).