C11H20N2O6 — CID 104877273
(2S)-2-[2-(2-methylpropoxy)ethylcarbamoylamino]butanedioic acid (PubChem CID 104877273) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2S)-2-[2-(2-methylpropoxy)ethylcarbamoylamino]butanedioic acid.
| Compound Name | (2S)-2-[2-(2-methylpropoxy)ethylcarbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 104877273 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2S)-2-[2-(2-methylpropoxy)ethylcarbamoylamino]butanedioic acid |
| SMILES | CC(C)COCCNC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O6/c1-7(2)6-19-4-3-12-11(18)13-8(10(16)17)5-9(14)15/h7-8H,3-6H2,1-2H3,(H,14,15)(H,16,17)(H2,12,13,18)/t8-/m0/s1 |
| InChIKey | JLBUPBQZGVOKTD-QMMMGPOBSA-N |
| XLogP | -0.11 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|