C8H14N4O6 — CID 83114385
(2R)-2-[2-(carbamoylamino)ethylcarbamoylamino]butanedioic acid (PubChem CID 83114385) has the molecular formula C8H14N4O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is (2R)-2-[2-(carbamoylamino)ethylcarbamoylamino]butanedioic acid.
| Compound Name | (2R)-2-[2-(carbamoylamino)ethylcarbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 83114385 |
| Molecular Formula | C8H14N4O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2R)-2-[2-(carbamoylamino)ethylcarbamoylamino]butanedioic acid |
| SMILES | NC(=O)NCCNC(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N4O6/c9-7(17)10-1-2-11-8(18)12-4(6(15)16)3-5(13)14/h4H,1-3H2,(H,13,14)(H,15,16)(H3,9,10,17)(H2,11,12,18)/t4-/m1/s1 |
| InChIKey | BSVBOQQWSNZJIH-SCSAIBSYSA-N |
| XLogP | -2.12 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|