C8H13N3O7 — CID 83204397
2-(2-carbamoyloxyethylcarbamoylamino)butanedioic acid (PubChem CID 83204397) has the molecular formula C8H13N3O7 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-(2-carbamoyloxyethylcarbamoylamino)butanedioic acid.
| Compound Name | 2-(2-carbamoyloxyethylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 83204397 |
| Molecular Formula | C8H13N3O7 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(2-carbamoyloxyethylcarbamoylamino)butanedioic acid |
| SMILES | NC(=O)OCCNC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13N3O7/c9-7(16)18-2-1-10-8(17)11-4(6(14)15)3-5(12)13/h4H,1-3H2,(H2,9,16)(H,12,13)(H,14,15)(H2,10,11,17) |
| InChIKey | KHVXJAYSQDTNQM-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|