C8H15N3O5 — CID 83205276
(2S)-2-(2-carbamoyloxyethylcarbamoylamino)butanoic acid (PubChem CID 83205276) has the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. Its IUPAC name is (2S)-2-(2-carbamoyloxyethylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-(2-carbamoyloxyethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 83205276 |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (2S)-2-(2-carbamoyloxyethylcarbamoylamino)butanoic acid |
| SMILES | CC[C@H](NC(=O)NCCOC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O5/c1-2-5(6(12)13)11-8(15)10-3-4-16-7(9)14/h5H,2-4H2,1H3,(H2,9,14)(H,12,13)(H2,10,11,15)/t5-/m0/s1 |
| InChIKey | JYORFFWQHNPSCJ-YFKPBYRVSA-N |
| XLogP | -0.76 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|