C12H23N3O5 — CID 63718851
(2S)-4-amino-2-[2-(3-methylbutoxy)ethylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 63718851) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2S)-4-amino-2-[2-(3-methylbutoxy)ethylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[2-(3-methylbutoxy)ethylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63718851 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (2S)-4-amino-2-[2-(3-methylbutoxy)ethylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | CC(C)CCOCCNC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H23N3O5/c1-8(2)3-5-20-6-4-14-12(19)15-9(11(17)18)7-10(13)16/h8-9H,3-7H2,1-2H3,(H2,13,16)(H,17,18)(H2,14,15,19)/t9-/m0/s1 |
| InChIKey | DUJZLWBBVHHBNU-VIFPVBQESA-N |
| XLogP | -0.32 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|