C10H19N3O4S — CID 113494157
(2S)-4-amino-2-(3-methylsulfanylbutylcarbamoylamino)-4-oxobutanoic acid (PubChem CID 113494157) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is (2S)-4-amino-2-(3-methylsulfanylbutylcarbamoylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-(3-methylsulfanylbutylcarbamoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 113494157 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2S)-4-amino-2-(3-methylsulfanylbutylcarbamoylamino)-4-oxobutanoic acid |
| SMILES | CSC(C)CCNC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O4S/c1-6(18-2)3-4-12-10(17)13-7(9(15)16)5-8(11)14/h6-7H,3-5H2,1-2H3,(H2,11,14)(H,15,16)(H2,12,13,17)/t6?,7-/m0/s1 |
| InChIKey | MSZRUYRGZTUMBV-MLWJPKLSSA-N |
| XLogP | -0.24 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |