C9H16N4O5 — CID 63714734
(2S)-4-amino-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid (PubChem CID 63714734) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63714734 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (2S)-4-amino-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid |
| SMILES | CCNC(=O)CNC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N4O5/c1-2-11-7(15)4-12-9(18)13-5(8(16)17)3-6(10)14/h5H,2-4H2,1H3,(H2,10,14)(H,11,15)(H,16,17)(H2,12,13,18)/t5-/m0/s1 |
| InChIKey | WLLSPIHKEOTPLI-YFKPBYRVSA-N |
| XLogP | -2.25 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |