C11H20N4O5 — CID 90954445
(2S)-4-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-4-oxobutanoic acid (PubChem CID 90954445) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90954445 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S)-4-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCNC(=O)CC[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H20N4O5/c1-2-14-9(17)4-3-6(12)10(18)15-7(11(19)20)5-8(13)16/h6-7H,2-5,12H2,1H3,(H2,13,16)(H,14,17)(H,15,18)(H,19,20)/t6-,7-/m0/s1 |
| InChIKey | BBEIXXUYCIRQEO-BQBZGAKWSA-N |
| XLogP | -2.33 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |