C12H22N4O5 — CID 87920148
(2S)-5-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 87920148) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87920148 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CCNC(=O)CC[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H22N4O5/c1-2-15-10(18)6-3-7(13)11(19)16-8(12(20)21)4-5-9(14)17/h7-8H,2-6,13H2,1H3,(H2,14,17)(H,15,18)(H,16,19)(H,20,21)/t7-,8-/m0/s1 |
| InChIKey | RKIQTHRNHRKHBX-YUMQZZPRSA-N |
| XLogP | -1.94 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |