C8H14N4O5 — CID 61197619
4-amino-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid (PubChem CID 61197619) has the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 4-amino-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61197619 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-amino-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]-4-oxobutanoic acid |
| SMILES | CNC(=O)CNC(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N4O5/c1-10-6(14)3-11-8(17)12-4(7(15)16)2-5(9)13/h4H,2-3H2,1H3,(H2,9,13)(H,10,14)(H,15,16)(H2,11,12,17) |
| InChIKey | QJBBMIXQLAMUIA-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |