C7H13N3O5 — CID 80756456
(2R)-3-hydroxy-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]propanoic acid (PubChem CID 80756456) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 80756456 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2R)-3-hydroxy-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
| SMILES | CNC(=O)CNC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C7H13N3O5/c1-8-5(12)2-9-7(15)10-4(3-11)6(13)14/h4,11H,2-3H2,1H3,(H,8,12)(H,13,14)(H2,9,10,15)/t4-/m1/s1 |
| InChIKey | XOCLSMFAYPJIOI-SCSAIBSYSA-N |
| XLogP | -2.52 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |