C7H14N4O3 — CID 144980882
N-methyl-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]acetamide (PubChem CID 144980882) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is N-methyl-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]acetamide.
| Compound Name | N-methyl-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 144980882 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-methyl-2-[[2-(methylamino)-2-oxoethyl]carbamoylamino]acetamide |
| SMILES | CNC(=O)CNC(=O)NCC(=O)NC |
| InChI | InChI=1S/C7H14N4O3/c1-8-5(12)3-10-7(14)11-4-6(13)9-2/h3-4H2,1-2H3,(H,8,12)(H,9,13)(H2,10,11,14) |
| InChIKey | JMISOJYURLRTPA-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |