C6H11N3O5 — CID 80751039
(2R)-2-[(2-amino-2-oxoethyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 80751039) has the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. Its IUPAC name is (2R)-2-[(2-amino-2-oxoethyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2-amino-2-oxoethyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80751039 |
| Molecular Formula | C6H11N3O5 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2R)-2-[(2-amino-2-oxoethyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | NC(=O)CNC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C6H11N3O5/c7-4(11)1-8-6(14)9-3(2-10)5(12)13/h3,10H,1-2H2,(H2,7,11)(H,12,13)(H2,8,9,14)/t3-/m1/s1 |
| InChIKey | QGLKNPILWRSINL-GSVOUGTGSA-N |
| XLogP | -2.78 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |