(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid

C5H8N2O5 — CID 171342285

IUPAC(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid
SMILESNC(=O)C(=O)N[C@@H](CO)C(=O)O
InChIInChI=1S/C5H8N2O5/c6-3(9)4(10)7-2(1-8)5(11)12/h2,8H,1H2,(H2,6,9)(H,7,10)(H,11,12)/t2-/m0/s1
InChIKeyZTWNTRJTNWAMJX-REOHCLBHSA-N
MW176.13 g/mol
LogP-2.97
Rot. Bonds3

About (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid

(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid (PubChem CID 171342285) has the molecular formula C5H8N2O5 and a molecular weight of 176.13 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid.

Molecular Properties

Compound Name(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid
PubChem CID171342285
Molecular FormulaC5H8N2O5
Molecular Weight176.13 g/mol
Exact Mass176.04
IUPAC Name(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid
SMILESNC(=O)C(=O)N[C@@H](CO)C(=O)O
InChIInChI=1S/C5H8N2O5/c6-3(9)4(10)7-2(1-8)5(11)12/h2,8H,1H2,(H2,6,9)(H,7,10)(H,11,12)/t2-/m0/s1
InChIKeyZTWNTRJTNWAMJX-REOHCLBHSA-N
XLogP-2.97
TPSA129.72 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.13
LogP ≤ 5-2.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid?
The IUPAC name of (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid (CID 171342285) is (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid.
What is the SMILES notation for (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid?
The canonical SMILES for (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid is NC(=O)C(=O)N[C@@H](CO)C(=O)O.
What is the InChIKey of (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid?
The InChIKey is ZTWNTRJTNWAMJX-REOHCLBHSA-N. The full InChI is InChI=1S/C5H8N2O5/c6-3(9)4(10)7-2(1-8)5(11)12/h2,8H,1H2,(H2,6,9)(H,7,10)(H,11,12)/t2-/m0/s1.
What are the key properties of (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid?
(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid has a molecular weight of 176.13 g/mol, XLogP of -2.97, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid is sourced from PubChem (CID 171342285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).