C5H8N2O5 — CID 171342285
(2S)-3-hydroxy-2-(oxamoylamino)propanoic acid (PubChem CID 171342285) has the molecular formula C5H8N2O5 and a molecular weight of 176.13 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid |
|---|---|
| PubChem CID | 171342285 |
| Molecular Formula | C5H8N2O5 |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | (2S)-3-hydroxy-2-(oxamoylamino)propanoic acid |
| SMILES | NC(=O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C5H8N2O5/c6-3(9)4(10)7-2(1-8)5(11)12/h2,8H,1H2,(H2,6,9)(H,7,10)(H,11,12)/t2-/m0/s1 |
| InChIKey | ZTWNTRJTNWAMJX-REOHCLBHSA-N |
| XLogP | -2.97 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|