C4H8NO4P — CID 178076766
3-hydroxy-2-(phosphanylcarbonylamino)propanoic acid (PubChem CID 178076766) has the molecular formula C4H8NO4P and a molecular weight of 165.08 g/mol. Its IUPAC name is 3-hydroxy-2-(phosphanylcarbonylamino)propanoic acid.
| Compound Name | 3-hydroxy-2-(phosphanylcarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 178076766 |
| Molecular Formula | C4H8NO4P |
| Molecular Weight | 165.08 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 3-hydroxy-2-(phosphanylcarbonylamino)propanoic acid |
| SMILES | O=C(P)NC(CO)C(=O)O |
| InChI | InChI=1S/C4H8NO4P/c6-1-2(3(7)8)5-4(9)10/h2,6H,1,10H2,(H,5,9)(H,7,8) |
| InChIKey | RFVHUCUMUSKAEA-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.08 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|