C7H12N2O6 — CID 22823992
(3S)-3-amino-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid (PubChem CID 22823992) has the molecular formula C7H12N2O6 and a molecular weight of 220.18 g/mol. Its IUPAC name is (3S)-3-amino-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22823992 |
| Molecular Formula | C7H12N2O6 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (3S)-3-amino-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C7H12N2O6/c8-3(1-5(11)12)6(13)9-4(2-10)7(14)15/h3-4,10H,1-2,8H2,(H,9,13)(H,11,12)(H,14,15)/t3-,4?/m0/s1 |
| InChIKey | DWBZEJHQQIURML-WUCPZUCCSA-N |
| XLogP | -2.65 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |