C10H17N3O8 — CID 18224076
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 18224076) has the molecular formula C10H17N3O8 and a molecular weight of 307.26 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18224076 |
| Molecular Formula | C10H17N3O8 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | NC(CO)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O8/c11-4(2-14)8(18)13-6(3-15)9(19)12-5(10(20)21)1-7(16)17/h4-6,14-15H,1-3,11H2,(H,12,19)(H,13,18)(H,16,17)(H,20,21) |
| InChIKey | PPCZVWHJWJFTFN-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |