C18H27N5O14 — CID 52950605
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 52950605) has the molecular formula C18H27N5O14 and a molecular weight of 537.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 52950605 |
| Molecular Formula | C18H27N5O14 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H27N5O14/c19-6(1-11(26)27)14(32)22-9(4-24)16(34)20-7(2-12(28)29)15(33)23-10(5-25)17(35)21-8(18(36)37)3-13(30)31/h6-10,24-25H,1-5,19H2,(H,20,34)(H,21,35)(H,22,32)(H,23,33)(H,26,27)(H,28,29)(H,30,31)(H,36,37)/t6-,7-,8-,9-,10-/m0/s1 |
| InChIKey | LNWIZSRJNYVLBM-WYCDGMCDSA-N |
| XLogP | -6.25 |
| TPSA | 332.08 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |