C8H12N2O7 — CID 87433801
(2S)-2-[(2-amino-3-carboxypropanoyl)amino]butanedioic acid (PubChem CID 87433801) has the molecular formula C8H12N2O7 and a molecular weight of 248.19 g/mol. Its IUPAC name is (2S)-2-[(2-amino-3-carboxypropanoyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(2-amino-3-carboxypropanoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 87433801 |
| Molecular Formula | C8H12N2O7 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (2S)-2-[(2-amino-3-carboxypropanoyl)amino]butanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N2O7/c9-3(1-5(11)12)7(15)10-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H,10,15)(H,11,12)(H,13,14)(H,16,17)/t3?,4-/m0/s1 |
| InChIKey | FRYULLIZUDQONW-BKLSDQPFSA-N |
| XLogP | -2.17 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |