C10H17N3O6S2 — CID 145454690
(2S)-2-[[(2R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 145454690) has the molecular formula C10H17N3O6S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 145454690 |
| Molecular Formula | C10H17N3O6S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S2/c11-4(2-20)8(16)13-6(3-21)9(17)12-5(10(18)19)1-7(14)15/h4-6,20-21H,1-3,11H2,(H,12,17)(H,13,16)(H,14,15)(H,18,19)/t4-,5-,6-/m0/s1 |
| InChIKey | GGIHYKLJUIZYGH-ZLUOBGJFSA-N |
| XLogP | -2.30 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|