C7H13N3O4S — CID 18218192
4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid (PubChem CID 18218192) has the molecular formula C7H13N3O4S and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218192 |
| Molecular Formula | C7H13N3O4S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C7H13N3O4S/c8-3(2-15)6(12)10-4(7(13)14)1-5(9)11/h3-4,15H,1-2,8H2,(H2,9,11)(H,10,12)(H,13,14) |
| InChIKey | AYKQJQVWUYEZNU-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|