C17H30N6O8S — CID 18255506
2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18255506) has the molecular formula C17H30N6O8S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18255506 |
| Molecular Formula | C17H30N6O8S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(NC(=O)C(CC(N)=O)NC(=O)C(N)CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H30N6O8S/c18-4-2-1-3-9(15(28)23-11(17(30)31)6-13(25)26)21-16(29)10(5-12(20)24)22-14(27)8(19)7-32/h8-11,32H,1-7,18-19H2,(H2,20,24)(H,21,29)(H,22,27)(H,23,28)(H,25,26)(H,30,31) |
| InChIKey | RIDPCJOCVKWINR-UHFFFAOYSA-N |
| XLogP | -3.74 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|