C16H30N6O6S — CID 18258914
2-[[4-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]propanoic acid (PubChem CID 18258914) has the molecular formula C16H30N6O6S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[[4-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 2-[[4-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18258914 |
| Molecular Formula | C16H30N6O6S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[[4-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CC(N)=O)NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C16H30N6O6S/c1-8(16(27)28)20-15(26)11(6-12(19)23)22-14(25)10(4-2-3-5-17)21-13(24)9(18)7-29/h8-11,29H,2-7,17-18H2,1H3,(H2,19,23)(H,20,26)(H,21,24)(H,22,25)(H,27,28) |
| InChIKey | LNSUIRMIRUHQBG-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|