C10H17N3O7 — CID 145453661
(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 145453661) has the molecular formula C10H17N3O7 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 145453661 |
| Molecular Formula | C10H17N3O7 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O7/c1-4(11)8(17)13-6(3-14)9(18)12-5(10(19)20)2-7(15)16/h4-6,14H,2-3,11H2,1H3,(H,12,18)(H,13,17)(H,15,16)(H,19,20)/t4-,5-,6-/m0/s1 |
| InChIKey | RMAWDDRDTRSZIR-ZLUOBGJFSA-N |
| XLogP | -3.15 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |