C10H18N4O6 — CID 18218507
4-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18218507) has the molecular formula C10H18N4O6 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218507 |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(N)C(=O)NC(CO)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N4O6/c1-4(11)8(17)14-6(3-15)9(18)13-5(10(19)20)2-7(12)16/h4-6,15H,2-3,11H2,1H3,(H2,12,16)(H,13,18)(H,14,17)(H,19,20) |
| InChIKey | KLALXKYLOMZDQT-UHFFFAOYSA-N |
| XLogP | -3.74 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |