C9H15N3O7 — CID 18219508
3-amino-4-[[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoethyl]amino]-4-oxobutanoic acid (PubChem CID 18219508) has the molecular formula C9H15N3O7 and a molecular weight of 277.23 g/mol. Its IUPAC name is 3-amino-4-[[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18219508 |
| Molecular Formula | C9H15N3O7 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-amino-4-[[2-[(1-carboxy-2-hydroxyethyl)amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C9H15N3O7/c10-4(1-7(15)16)8(17)11-2-6(14)12-5(3-13)9(18)19/h4-5,13H,1-3,10H2,(H,11,17)(H,12,14)(H,15,16)(H,18,19) |
| InChIKey | SNDBKTFJWVEVPO-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |