C13H20N4O9 — CID 18249442
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]acetyl]amino]pentanedioic acid (PubChem CID 18249442) has the molecular formula C13H20N4O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18249442 |
| Molecular Formula | C13H20N4O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]acetyl]amino]pentanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)NCC(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H20N4O9/c14-6(3-11(22)23)12(24)16-4-8(18)15-5-9(19)17-7(13(25)26)1-2-10(20)21/h6-7H,1-5,14H2,(H,15,18)(H,16,24)(H,17,19)(H,20,21)(H,22,23)(H,25,26) |
| InChIKey | DOKPPKQTQWTQCY-UHFFFAOYSA-N |
| XLogP | -3.55 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |