C5H9NO6 — CID 175753352
(2S)-2-[(2,2-dihydroxyacetyl)amino]-3-hydroxypropanoic acid (PubChem CID 175753352) has the molecular formula C5H9NO6 and a molecular weight of 179.13 g/mol. Its IUPAC name is (2S)-2-[(2,2-dihydroxyacetyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(2,2-dihydroxyacetyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175753352 |
| Molecular Formula | C5H9NO6 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (2S)-2-[(2,2-dihydroxyacetyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(N[C@@H](CO)C(=O)O)C(O)O |
| InChI | InChI=1S/C5H9NO6/c7-1-2(4(9)10)6-3(8)5(11)12/h2,5,7,11-12H,1H2,(H,6,8)(H,9,10)/t2-/m0/s1 |
| InChIKey | LAKUVIYGAZAROW-REOHCLBHSA-N |
| XLogP | -3.14 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|