C8H14N2O5 — CID 61153507
(2S)-2-(2-acetamidopropanoylamino)-3-hydroxypropanoic acid (PubChem CID 61153507) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2S)-2-(2-acetamidopropanoylamino)-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-(2-acetamidopropanoylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61153507 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2S)-2-(2-acetamidopropanoylamino)-3-hydroxypropanoic acid |
| SMILES | CC(=O)NC(C)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-4(9-5(2)12)7(13)10-6(3-11)8(14)15/h4,6,11H,3H2,1-2H3,(H,9,12)(H,10,13)(H,14,15)/t4?,6-/m0/s1 |
| InChIKey | OHDMDPKNKIIBFQ-RZKHNPSRSA-N |
| XLogP | -1.93 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |