C12H22N4O6 — CID 18232597
2-[2-[2-(2-aminopropanoylamino)propanoylamino]propanoylamino]-3-hydroxypropanoic acid (PubChem CID 18232597) has the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[2-[2-(2-aminopropanoylamino)propanoylamino]propanoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[2-[2-(2-aminopropanoylamino)propanoylamino]propanoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18232597 |
| Molecular Formula | C12H22N4O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[2-[2-(2-aminopropanoylamino)propanoylamino]propanoylamino]-3-hydroxypropanoic acid |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C12H22N4O6/c1-5(13)9(18)14-6(2)10(19)15-7(3)11(20)16-8(4-17)12(21)22/h5-8,17H,4,13H2,1-3H3,(H,14,18)(H,15,19)(H,16,20)(H,21,22) |
| InChIKey | CKAPPXBMIVQTMA-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |