C21H37N7O8 — CID 101209600
(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 101209600) has the molecular formula C21H37N7O8 and a molecular weight of 515.57 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101209600 |
| Molecular Formula | C21H37N7O8 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | C[C@@H](N)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C21H37N7O8/c1-8(22)15(29)23-9(2)16(30)24-10(3)17(31)25-11(4)18(32)26-12(5)19(33)27-13(6)20(34)28-14(7)21(35)36/h8-14H,22H2,1-7H3,(H,23,29)(H,24,30)(H,25,31)(H,26,32)(H,27,33)(H,28,34)(H,35,36)/t8-,9-,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | HHSZNYSHUHHHLF-FPAHTUGESA-N |
| XLogP | -3.55 |
| TPSA | 237.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |